![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| molecular histogenes..> | 2006-04-25 15:49 | 271K | |
| Vh3-72 in CLL.pdf | 1987-12-31 23:10 | 134K | |
| PBL of the oral cavi..> | 2002-11-25 08:21 | 156K | |
| Abstract.doc | 1987-12-31 23:26 | 42K | |
| Aberrant somatic hyp..> | 1987-12-31 23:48 | 284K | |
| Aberrant SHM in medi..> | 1987-12-31 23:25 | 94K | |
| Aberrant SHM in PTLD..> | 1987-12-31 23:23 | 69K | |
| Aberrant SHM in HCV ..> | 1987-12-31 23:07 | 101K | |